CAS 22256-76-4 is the registry number for Methyl 2-acetamido-2-deoxy-β-D-galactopyranoside. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 50mg.
Methyl N-acetyl-beta-D-galactosaminide is an N-acetyl-beta-D-galactosaminide having a methyl substituent at the anomeric position.
Source: ChEBI
| Molecular formula | C9H17NO6 |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | N-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]acetamide |
| InChIKey | ZEVOCXOZYFLVKN-SYHAXYEDSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1OC)CO)O)O |
Computed by PubChem (NCBI)