Products 1956306-28-7

CAS 1956306-28-7 is the registry number for 2-(Azocan-1-yl)-2-phenylacetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-(azocan-1-yl)-2-phenylacetic acid;hydrochloride (CAS 1956306-28-7) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 283.79 g/mol. IUPAC name: 2-(azocan-1-yl)-2-phenylacetic acid;hydrochloride. InChIKey: LAKWCPKGJHLVJL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22ClNO2
Molecular weight283.79 g/mol
IUPAC name2-(azocan-1-yl)-2-phenylacetic acid;hydrochloride
InChIKeyLAKWCPKGJHLVJL-UHFFFAOYSA-N
SMILESC1CCCN(CCC1)C(C2=CC=CC=C2)C(=O)O.Cl

Computed by PubChem (NCBI)