CAS 2270905-14-9 is the registry number for 4-[(Cyclopropyl-isobutyl-amino)-methyl]-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[[cyclopropyl(2-methylpropyl)amino]methyl]benzoic acid;hydrochloride (CAS 2270905-14-9) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 283.79 g/mol. IUPAC name: 4-[[cyclopropyl(2-methylpropyl)amino]methyl]benzoic acid;hydrochloride. InChIKey: SFIDRXHHNRZFTJ-UHFFFAOYSA-N.
| Molecular formula | C15H22ClNO2 |
|---|---|
| Molecular weight | 283.79 g/mol |
| IUPAC name | 4-[[cyclopropyl(2-methylpropyl)amino]methyl]benzoic acid;hydrochloride |
| InChIKey | SFIDRXHHNRZFTJ-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC1=CC=C(C=C1)C(=O)O)C2CC2.Cl |
Computed by PubChem (NCBI)