Products 25979-24-2

CAS 25979-24-2 is the registry number for Ethyl 2-benzylpiperidine-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-benzylpiperidine-2-carboxylate;hydrochloride (CAS 25979-24-2) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 283.79 g/mol. IUPAC name: ethyl 2-benzylpiperidine-2-carboxylate;hydrochloride. InChIKey: WGSQNBOUUWMBNL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22ClNO2
Molecular weight283.79 g/mol
IUPAC nameethyl 2-benzylpiperidine-2-carboxylate;hydrochloride
InChIKeyWGSQNBOUUWMBNL-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCCCN1)CC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)