CAS 1956309-28-6 is the registry number for Vonoprazan Impurity 128. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-fluorophenyl)-1H-pyrrole-3-carboxamide (CAS 1956309-28-6) is a chemical compound with the molecular formula C11H9FN2O and a molecular weight of 204.20 g/mol. IUPAC name: 5-(2-fluorophenyl)-1H-pyrrole-3-carboxamide. InChIKey: NLFBJXFRJOOPQC-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1H-pyrrole-3-carboxamide |
| InChIKey | NLFBJXFRJOOPQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CN2)C(=O)N)F |
Computed by PubChem (NCBI)