CAS 1956318-09-4 is the registry number for 1,3–dimethyl–6–phenyl–1,5–dihydro–4H–pyrazolo(3,4–d)pyrimidin–4–one. Offered by: GLPBio. Available pack sizes: 200mg.
1,3-dimethyl-6-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1956318-09-4) is a chemical compound with the molecular formula C13H12N4O and a molecular weight of 240.26 g/mol. IUPAC name: 1,3-dimethyl-6-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: DLICNUMCJSUDDG-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1,3-dimethyl-6-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | DLICNUMCJSUDDG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=O)NC(=N2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)