CAS 1956318-12-9 is the registry number for 5–chloro–3H–spiro(isobenzofuran–1,4'–piperidin)–3–one hydrochloride. Offered by: GLPBio. Available pack sizes: 1g, 500mg, 5g.
6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one;hydrochloride (CAS 1956318-12-9) is a chemical compound with the molecular formula C12H13Cl2NO2 and a molecular weight of 274.14 g/mol. IUPAC name: 6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one;hydrochloride. InChIKey: LPHJMKJMWOHSFP-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO2 |
|---|---|
| Molecular weight | 274.14 g/mol |
| IUPAC name | 6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one;hydrochloride |
| InChIKey | LPHJMKJMWOHSFP-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=C(C=C3)Cl)C(=O)O2.Cl |
Computed by PubChem (NCBI)