CAS 1956325-65-7 is the registry number for 4-(((tert-Butoxycarbonyl)amino)methyl)bicyclo(2.2.1)heptane-1-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]bicyclo[2.2.1]heptane-1-carboxylic acid (CAS 1956325-65-7) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]bicyclo[2.2.1]heptane-1-carboxylic acid. InChIKey: VZRXFTAEYUERGX-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]bicyclo[2.2.1]heptane-1-carboxylic acid |
| InChIKey | VZRXFTAEYUERGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC12CCC(C1)(CC2)C(=O)O |
Computed by PubChem (NCBI)