CAS 1956327-11-9 is the registry number for 6,7,8,9-Tetrahydro-4h-pyrazino[1,2-a]pyrimidin-4-one dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one;dihydrochloride (CAS 1956327-11-9) is a chemical compound with the molecular formula C7H11Cl2N3O and a molecular weight of 224.08 g/mol. IUPAC name: 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one;dihydrochloride. InChIKey: VXHAKCTYMRUGEU-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N3O |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 6,7,8,9-tetrahydropyrazino[1,2-a]pyrimidin-4-one;dihydrochloride |
| InChIKey | VXHAKCTYMRUGEU-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NC=CC2=O)CN1.Cl.Cl |
Computed by PubChem (NCBI)