Products 21050-97-5
CAS 21050-97-5 appears in our catalog under these names: 2-Amino-N-(pyridin-2-yl)acetamide dihydrochloride, 98%, 2-Amino-N-(pyridin-2-yl)acetamide dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 2,5g, 250mg.
2-amino-N-pyridin-2-ylacetamide;dihydrochloride (CAS 21050-97-5) is a chemical compound with the molecular formula C7H11Cl2N3O and a molecular weight of 224.08 g/mol. IUPAC name: 2-amino-N-pyridin-2-ylacetamide;dihydrochloride. InChIKey: NOTFFHYXKCNVFK-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N3O |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 2-amino-N-pyridin-2-ylacetamide;dihydrochloride |
| InChIKey | NOTFFHYXKCNVFK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC(=O)CN.Cl.Cl |
Computed by PubChem (NCBI)