Products 266993-72-0
CAS 266993-72-0 appears in our catalog under these names: 2,3-Diaminobenzamide dihydrochloride, 95%, 95%, 2,3-Diaminobenzamide dihydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,3-diaminobenzamide;dihydrochloride (CAS 266993-72-0) is a chemical compound with the molecular formula C7H11Cl2N3O and a molecular weight of 224.08 g/mol. IUPAC name: 2,3-diaminobenzamide;dihydrochloride. InChIKey: QRZIEYWNYLXKSK-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N3O |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 2,3-diaminobenzamide;dihydrochloride |
| InChIKey | QRZIEYWNYLXKSK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)N)C(=O)N.Cl.Cl |
Computed by PubChem (NCBI)