CAS 1956365-01-7 is the registry number for 8-Bromo-4-fluoroquinoline, 97%. Offered by: AmBeed. Available pack sizes: 1g.
8-bromo-4-fluoroquinoline (CAS 1956365-01-7) is a chemical compound with the molecular formula C9H5BrFN and a molecular weight of 226.04 g/mol. IUPAC name: 8-bromo-4-fluoroquinoline. InChIKey: YEIOPHMCROVHEQ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFN |
|---|---|
| Molecular weight | 226.04 g/mol |
| IUPAC name | 8-bromo-4-fluoroquinoline |
| InChIKey | YEIOPHMCROVHEQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)Br)F |
Computed by PubChem (NCBI)