Products 1956382-42-5
CAS 1956382-42-5 appears in our catalog under these names: Phenetrazine (hydrochloride), Phenetrazine Hydrochloride, >95% (HPLC), 3-Ethyl-2-phenylmorpholine hydrochloride, Phenetrazine Hydrochloride, 95%, 95%, 3-Ethyl-2-phenylmorpholine (hydrochloride). Offered by: GLPBio, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 10mg, 50mg, 1mg, 25mg, 5 mg, 1 mg.
3-ethyl-2-phenylmorpholine;hydrochloride (CAS 1956382-42-5) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 3-ethyl-2-phenylmorpholine;hydrochloride. InChIKey: JBDLPMIDSZBBQJ-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 3-ethyl-2-phenylmorpholine;hydrochloride |
| InChIKey | JBDLPMIDSZBBQJ-UHFFFAOYSA-N |
| SMILES | CCC1C(OCCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)