Products 1956382-83-4
CAS 1956382-83-4 is the registry number for 4-Bromo-3-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
4-bromo-3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine (CAS 1956382-83-4) is a chemical compound with the molecular formula C7H3BrF3N3 and a molecular weight of 266.02 g/mol. IUPAC name: 4-bromo-3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine. InChIKey: RNKVHZPURBYKSS-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3N3 |
|---|---|
| Molecular weight | 266.02 g/mol |
| IUPAC name | 4-bromo-3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine |
| InChIKey | RNKVHZPURBYKSS-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(NN=C2N=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)