CAS 1958100-79-2 is the registry number for 4-Nitrofluorobenzene-13C6. Offered by: TRC. Available pack sizes: 25mg.
1-fluoro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 1958100-79-2) is a chemical compound with the molecular formula C6H4FNO2 and a molecular weight of 147.056 g/mol. IUPAC name: 1-fluoro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: WFQDTOYDVUWQMS-IDEBNGHGSA-N.
| Molecular formula | C6H4FNO2 |
|---|---|
| Molecular weight | 147.056 g/mol |
| IUPAC name | 1-fluoro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | WFQDTOYDVUWQMS-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1[N+](=O)[O-])F |
Computed by PubChem (NCBI)