CAS 1958125-89-7 is the registry number for (R)–2–amino–2–cyclobutylacetic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(2R)-2-amino-2-cyclobutylacetic acid;hydrochloride (CAS 1958125-89-7) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: (2R)-2-amino-2-cyclobutylacetic acid;hydrochloride. InChIKey: SUOZIIJENXIMGX-NUBCRITNSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | (2R)-2-amino-2-cyclobutylacetic acid;hydrochloride |
| InChIKey | SUOZIIJENXIMGX-NUBCRITNSA-N |
| SMILES | C1CC(C1)[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)