CAS 19616-28-5 appears in our catalog under these names: Bis(2,4–dimethylphenyl)amine, Bis(2,4-dimethylphenyl)amine, >98.0%(GC), Bis(2,4-dimethylphenyl)amine 97%, N-(2,4-Dimethylphenyl)-2,4-dimethylbenzenamine, 97%, 97%, Bis(2,4-dimethylphenyl)amine, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 200mg, 1g, 250mg, 5g, 10g, 25g, 100mg.
N-(2,4-dimethylphenyl)-2,4-dimethylaniline (CAS 19616-28-5) is a chemical compound with the molecular formula C16H19N and a molecular weight of 225.33 g/mol. IUPAC name: N-(2,4-dimethylphenyl)-2,4-dimethylaniline. InChIKey: MAINCNYZMOMWRA-UHFFFAOYSA-N.
| Molecular formula | C16H19N |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)-2,4-dimethylaniline |
| InChIKey | MAINCNYZMOMWRA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC2=C(C=C(C=C2)C)C)C |
Computed by PubChem (NCBI)