CAS 19625-68-4 is the registry number for 2-Nitrobenzene-1,3,5-tricarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-nitrobenzene-1,3,5-tricarboxylic acid (CAS 19625-68-4) is a chemical compound with the molecular formula C9H5NO8 and a molecular weight of 255.14 g/mol. IUPAC name: 2-nitrobenzene-1,3,5-tricarboxylic acid. InChIKey: BOUYXKZEBJHJBT-UHFFFAOYSA-N.
| Molecular formula | C9H5NO8 |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 2-nitrobenzene-1,3,5-tricarboxylic acid |
| InChIKey | BOUYXKZEBJHJBT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)[N+](=O)[O-])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)