Products 19625-68-4

CAS 19625-68-4 is the registry number for 2-Nitrobenzene-1,3,5-tricarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-nitrobenzene-1,3,5-tricarboxylic acid (CAS 19625-68-4) is a chemical compound with the molecular formula C9H5NO8 and a molecular weight of 255.14 g/mol. IUPAC name: 2-nitrobenzene-1,3,5-tricarboxylic acid. InChIKey: BOUYXKZEBJHJBT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5NO8
Molecular weight255.14 g/mol
IUPAC name2-nitrobenzene-1,3,5-tricarboxylic acid
InChIKeyBOUYXKZEBJHJBT-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)[N+](=O)[O-])C(=O)O)C(=O)O

Computed by PubChem (NCBI)