Products 35555-66-9

CAS 35555-66-9 is the registry number for 6-Nitrobenzene-1,2,4-tricarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-nitrobenzene-1,2,4-tricarboxylic acid (CAS 35555-66-9) is a chemical compound with the molecular formula C9H5NO8 and a molecular weight of 255.14 g/mol. IUPAC name: 6-nitrobenzene-1,2,4-tricarboxylic acid. InChIKey: FAPSHMSSVKCNBN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5NO8
Molecular weight255.14 g/mol
IUPAC name6-nitrobenzene-1,2,4-tricarboxylic acid
InChIKeyFAPSHMSSVKCNBN-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)C(=O)O)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)