CAS 3807-81-6 appears in our catalog under these names: 5-Nitro-1,2,3-benzenetricarboxylic acid, 95%, 5-Nitrobenzene-1,2,3-tricarboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100g.
5-nitrobenzene-1,2,3-tricarboxylic acid (CAS 3807-81-6) is a chemical compound with the molecular formula C9H5NO8 and a molecular weight of 255.14 g/mol. IUPAC name: 5-nitrobenzene-1,2,3-tricarboxylic acid. InChIKey: KIRNHRJGEAFKPM-UHFFFAOYSA-N.
| Molecular formula | C9H5NO8 |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 5-nitrobenzene-1,2,3-tricarboxylic acid |
| InChIKey | KIRNHRJGEAFKPM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)C(=O)O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)