CAS 196394-48-6 appears in our catalog under these names: Methyl (2S,4S)-1-(tert-butoxycarbonyl)-4-methylpyroglutamate, 98%, 98%, 1-(tert-Butyl) 2-methyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g.
1-O-tert-butyl 2-O-methyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate (CAS 196394-48-6) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: YTLCHNBFNGFDSD-YUMQZZPRSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | YTLCHNBFNGFDSD-YUMQZZPRSA-N |
| SMILES | C[C@H]1C[C@H](N(C1=O)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)