CAS 879374-48-8 appears in our catalog under these names: Methyl (2r,4s)-1-boc-4-methyl-5-oxo-pyrrolidine-2-carboxylate, 95%, 1–tert–Butyl 2–methyl (2R,4S)–4–methyl–5–oxopyrrolidine–1,2–dicarboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate (CAS 879374-48-8) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: YTLCHNBFNGFDSD-JGVFFNPUSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | YTLCHNBFNGFDSD-JGVFFNPUSA-N |
| SMILES | C[C@H]1C[C@@H](N(C1=O)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)