CAS 19641-63-5 appears in our catalog under these names: D-Alpha-aminosuberic acid, 95%, D-α-Aminosuberic acid, D-ALPHA-AMINOSUBERIC ACID, 95%, 95%, (R)-2-Aminooctanedioic acid, 95%, H-D-Asu-OH, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 5g, 250mg, 50mg, 500mg, 1000mg.
(2R)-2-aminooctanedioic acid (CAS 19641-63-5) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2R)-2-aminooctanedioic acid. InChIKey: YOFPFYYTUIARDI-ZCFIWIBFSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2R)-2-aminooctanedioic acid |
| InChIKey | YOFPFYYTUIARDI-ZCFIWIBFSA-N |
| SMILES | C(CC[C@H](C(=O)O)N)CCC(=O)O |
Computed by PubChem (NCBI)