Products 4125-93-3
CAS 4125-93-3 appears in our catalog under these names: H-Asp-OtBu, 95%, L-Aspartic Acid 1-tert-Butyl Ester, H–Asp–OtBu, L-Aspartic acid alpha-tert-butyl ester, H-Asp-OtBu 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 10g, 25g, 100g, 5g, 2g, 250mg, 500g.
(3S)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 4125-93-3) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (3S)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: PUWCNJZIFKBDJQ-YFKPBYRVSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (3S)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | PUWCNJZIFKBDJQ-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
H-Asp-OtBu, L-Aspartic acid 1-tert-butyl ester, (S)-3-Amino-4-(tert-butoxy)-4-oxobutanoic acid, L-Aspartic Acid tert-Butyl Ester, L-Aspartic acid a-tert-butyl ester, (3s)-3-amino-4-tert-butoxy-4-oxobutanoic acid, L-Asp-OtBu, D-Aspartic Acid 1-tert-Butyl Ester, (S)-3-amino-4-tert-butoxy-4-oxobutanoic acid, D-Aspartic Acid 1-(1,1-Dimethylethyl) Ester