CAS 162537-11-3 appears in our catalog under these names: Methoxycarbonyl-L-tert-Leucine, 97%, Atazanavir related compound A, N-(Methoxycarbonyl)-L-tert-leucine, >95% (HPLC), (S)-2-(Methoxycarbonylamino)-3,3-dimethylbutanoic Acid, (S)–2–(Methoxycarbonylamino)–3,3–dimethylbutanoic acid. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 25g, 500g, 5g, 1g, 100g, on request, 500mg, 25mg.
(2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid (CAS 162537-11-3) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid. InChIKey: NWPRXAIYBULIEI-RXMQYKEDSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid |
| InChIKey | NWPRXAIYBULIEI-RXMQYKEDSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)OC |
Computed by PubChem (NCBI)