Products 1965309-40-3
CAS 1965309-40-3 appears in our catalog under these names: 2,3-Dihydro-1H-isoindole-4-carboxylic acid hydrochloride, 2,3-Dihydro-1H-isoindole-4-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3-dihydro-1H-isoindole-4-carboxylic acid;hydrochloride (CAS 1965309-40-3) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2,3-dihydro-1H-isoindole-4-carboxylic acid;hydrochloride. InChIKey: WPTYORQMGZIYAC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2,3-dihydro-1H-isoindole-4-carboxylic acid;hydrochloride |
| InChIKey | WPTYORQMGZIYAC-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C(=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)