Products 1965310-29-5

CAS 1965310-29-5 is the registry number for 2-(1H-Pyrazol-4-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(1H-pyrazol-4-yl)acetic acid;hydrochloride (CAS 1965310-29-5) is a chemical compound with the molecular formula C5H7ClN2O2 and a molecular weight of 162.57 g/mol. IUPAC name: 2-(1H-pyrazol-4-yl)acetic acid;hydrochloride. InChIKey: IPNJYJRCWYVYGT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7ClN2O2
Molecular weight162.57 g/mol
IUPAC name2-(1H-pyrazol-4-yl)acetic acid;hydrochloride
InChIKeyIPNJYJRCWYVYGT-UHFFFAOYSA-N
SMILESC1=C(C=NN1)CC(=O)O.Cl

Computed by PubChem (NCBI)