Products 1965310-36-4
CAS 1965310-36-4 is the registry number for Trans-2-tert-butoxycarbonylamino-1-methyl-cyclopentanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1R,2R)-1-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 1965310-36-4) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: cis-(1R,2R)-1-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: RELMMCLJMQTQFA-PRHODGIISA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | cis-(1R,2R)-1-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | RELMMCLJMQTQFA-PRHODGIISA-N |
| SMILES | C[C@]1(CCC[C@H]1NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)