CAS 19686-05-6 appears in our catalog under these names: 2,8-dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 95%, 2,8-Dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole 98%, 2,8-Dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 98%, 98%, 2,8-Dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]-indole, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 250mg, 100mg.
2,8-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (CAS 19686-05-6) is a chemical compound with the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. IUPAC name: 2,8-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole. InChIKey: MUZFLDUALLSEBH-UHFFFAOYSA-N.
| Molecular formula | C13H16N2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 2,8-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| InChIKey | MUZFLDUALLSEBH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2CN(CC3)C |
Computed by PubChem (NCBI)