CAS 943117-83-7 appears in our catalog under these names: 5-(2,5-Dimethyl-1h-pyrrol-1-yl)-2-methylaniline, 95%, 5-(2,5-Dimethyl-1H-pyrrol-1-yl)-2-methylaniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
5-(2,5-dimethylpyrrol-1-yl)-2-methylaniline (CAS 943117-83-7) is a chemical compound with the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. IUPAC name: 5-(2,5-dimethylpyrrol-1-yl)-2-methylaniline. InChIKey: MBMCDTHUOFTHRR-UHFFFAOYSA-N.
| Molecular formula | C13H16N2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 5-(2,5-dimethylpyrrol-1-yl)-2-methylaniline |
| InChIKey | MBMCDTHUOFTHRR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=CC=C2C)C)N |
Computed by PubChem (NCBI)