CAS 443890-09-3 appears in our catalog under these names: 1-Benzyl-4-isocyanopiperidine, 95%, 1-Benzyl-4-isocyanopiperidine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
1-benzyl-4-isocyanopiperidine (CAS 443890-09-3) is a chemical compound with the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. IUPAC name: 1-benzyl-4-isocyanopiperidine. InChIKey: MSPAZUBEMCLWCB-UHFFFAOYSA-N.
| Molecular formula | C13H16N2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 1-benzyl-4-isocyanopiperidine |
| InChIKey | MSPAZUBEMCLWCB-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C1CCN(CC1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)