CAS 1969288-37-6 is the registry number for rac-(5R,6R)-7-Methyl-8-oxo-6-phenyl-7-azaspiro(3.5)nonane-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 25mg, 0,25g.
(8S,9S)-7-methyl-6-oxo-8-phenyl-7-azaspiro[3.5]nonane-9-carboxylic acid (CAS 1969288-37-6) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: (8S,9S)-7-methyl-6-oxo-8-phenyl-7-azaspiro[3.5]nonane-9-carboxylic acid. InChIKey: XLYBISXZWBSQTF-UONOGXRCSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | (8S,9S)-7-methyl-6-oxo-8-phenyl-7-azaspiro[3.5]nonane-9-carboxylic acid |
| InChIKey | XLYBISXZWBSQTF-UONOGXRCSA-N |
| SMILES | CN1[C@@H]([C@H](C2(CCC2)CC1=O)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)