CAS 197075-60-8 is the registry number for Tosylamidoxime. Offered by: Chemat Brand. Available pack sizes: on request.
(1-aminoethylideneamino) 4-methylbenzenesulfonate (CAS 197075-60-8) is a chemical compound with the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. IUPAC name: (1-aminoethylideneamino) 4-methylbenzenesulfonate. InChIKey: ATJHLRRHTHOZAF-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | (1-aminoethylideneamino) 4-methylbenzenesulfonate |
| InChIKey | ATJHLRRHTHOZAF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)ON=C(C)N |
Computed by PubChem (NCBI)