CAS 197227-85-3 appears in our catalog under these names: Adenosine-15N N1-Oxide, Adenosine N1-oxide-15N. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
(2R,3R,4S,5R)-2-(6-(15N)azanylidene-1-hydroxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 197227-85-3) is a chemical compound with the molecular formula C10H13N5O5 and a molecular weight of 284.23 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-(15N)azanylidene-1-hydroxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: QHFLZHVITNUFMV-ZGUONDJVSA-N.
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-(15N)azanylidene-1-hydroxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | QHFLZHVITNUFMV-ZGUONDJVSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=CN(C2=[15NH])O |
Computed by PubChem (NCBI)