CAS 19728-20-2 appears in our catalog under these names: 2-(5-Isopropyl-2-methylphenoxy)acetic acid, 95+%, (5-Isopropyl-2-methyl-phenoxy)-acetic acid, (5-Isopropyl-2-methyl-phenoxy)-acetic acid, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 2,5g, 100mg, 1g.
2-(2-methyl-5-propan-2-ylphenoxy)acetic acid (CAS 19728-20-2) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2-(2-methyl-5-propan-2-ylphenoxy)acetic acid. InChIKey: OWRFHSFWUCJFQE-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2-(2-methyl-5-propan-2-ylphenoxy)acetic acid |
| InChIKey | OWRFHSFWUCJFQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)C)OCC(=O)O |
Computed by PubChem (NCBI)