Products 1973415-50-7
CAS 1973415-50-7 appears in our catalog under these names: Lotaustralin, 2-(β-D-Glucopyranosyloxy)-2-methylbutanenitrile, ≥98%, ≥98%, Lotaustralin, 99.44%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 10 mg, 5 mg.
2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanenitrile (CAS 1973415-50-7) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: 2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanenitrile. InChIKey: WEWBWVMTOYUPHH-GXUZYPEDSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanenitrile |
| InChIKey | WEWBWVMTOYUPHH-GXUZYPEDSA-N |
| SMILES | CCC(C)(C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)