Products 1973459-69-6
CAS 1973459-69-6 is the registry number for methyl (1S,2S)-2-(aminomethyl)cyclopropanecarboxylate hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Cis-methyl (1S,2S)-2-(aminomethyl)cyclopropane-1-carboxylate;hydrochloride (CAS 1973459-69-6) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: cis-methyl (1S,2S)-2-(aminomethyl)cyclopropane-1-carboxylate;hydrochloride. InChIKey: QWMAQOHBCUYYNU-JBUOLDKXSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | cis-methyl (1S,2S)-2-(aminomethyl)cyclopropane-1-carboxylate;hydrochloride |
| InChIKey | QWMAQOHBCUYYNU-JBUOLDKXSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H]1CN.Cl |
Computed by PubChem (NCBI)