Products 197516-56-6
CAS 197516-56-6 is the registry number for 2-(2-Fluoro-6-methylphenyl)-4,4-dimethyl-4,5-dihydrooxazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-fluoro-6-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 197516-56-6) is a chemical compound with the molecular formula C12H14FNO and a molecular weight of 207.24 g/mol. IUPAC name: 2-(2-fluoro-6-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: KVYKZBUHIGYCOO-UHFFFAOYSA-N.
| Molecular formula | C12H14FNO |
|---|---|
| Molecular weight | 207.24 g/mol |
| IUPAC name | 2-(2-fluoro-6-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | KVYKZBUHIGYCOO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)F)C2=NC(CO2)(C)C |
Computed by PubChem (NCBI)