Products 1977-39-5

CAS 1977-39-5 is the registry number for (p-sec-Butylphenyl)acetic Acid. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 5000mg.

Structural formula: {0} (CAS {1})

2-(4-butan-2-ylphenyl)acetic acid (CAS 1977-39-5) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2-(4-butan-2-ylphenyl)acetic acid. InChIKey: GGIRQPMCEAWMBX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O2
Molecular weight192.25 g/mol
IUPAC name2-(4-butan-2-ylphenyl)acetic acid
InChIKeyGGIRQPMCEAWMBX-UHFFFAOYSA-N
SMILESCCC(C)C1=CC=C(C=C1)CC(=O)O

Computed by PubChem (NCBI)