Products 19786-48-2
CAS 19786-48-2 appears in our catalog under these names: Methyl (4-nitrophenoxy)acetate, 98%, Methyl 4-Nitrophenoxyacetate, methyl (4-nitrophenoxy)acetate, 95%, 95%. Offered by: Combi-blocks, TRC, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl 2-(4-nitrophenoxy)acetate (CAS 19786-48-2) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: methyl 2-(4-nitrophenoxy)acetate. InChIKey: ZZVXTAUUUUCLAG-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | methyl 2-(4-nitrophenoxy)acetate |
| InChIKey | ZZVXTAUUUUCLAG-UHFFFAOYSA-N |
| SMILES | COC(=O)COC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
methyl 2-(4-nitrophenoxy)acetate, methyl (4-nitrophenoxy)acetate, Methyl 4-nitrophenoxyacetate, Acetic acid, (4-nitrophenoxy)-, methyl ester, Acetic acid, 2-(4-nitrophenoxy)-, methyl ester, (4-Nitrophenoxy)acetic acid methyl ester, 4-Nitrophenoxyacetic acid methyl ester, Oprea1_145451, methyl 4-nitro-phenoxyacetate, Methyl(4-Nitro phenoxy)acetate