CAS 1979-49-3 appears in our catalog under these names: 1-Fluoro-3-(2-nitroethenyl)benzene, (E)-1-Fluoro-3-(2-Nitrovinyl)Benzene. Offered by: Biosynth, Chemat. Available pack sizes: 10g, 1g.
1-fluoro-3-[(E)-2-nitroethenyl]benzene (CAS 1979-49-3) is a chemical compound with the molecular formula C8H6FNO2 and a molecular weight of 167.14 g/mol. IUPAC name: 1-fluoro-3-[(E)-2-nitroethenyl]benzene. InChIKey: NOXNBNYWEWJUTM-SNAWJCMRSA-N.
| Molecular formula | C8H6FNO2 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | 1-fluoro-3-[(E)-2-nitroethenyl]benzene |
| InChIKey | NOXNBNYWEWJUTM-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)F)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)