CAS 198-88-9 is the registry number for Benzo[1,2-b:3,4-b']bisbenzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene (CAS 198-88-9) is a chemical compound with the molecular formula C18H10O2 and a molecular weight of 258.3 g/mol. IUPAC name: 9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene. InChIKey: XHMKWZVWPUQICX-UHFFFAOYSA-N.
| Molecular formula | C18H10O2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
| InChIKey | XHMKWZVWPUQICX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C4=C(C=C3)OC5=CC=CC=C54 |
Computed by PubChem (NCBI)