CAS 2498-66-0 appears in our catalog under these names: 1,2-Benzanthraquinone, 95%, Benz(a)anthracene-7,12-dione, >95% (HPLC), 1,2–Benzanthraquinone, 1,2-Benzanthraquinone, 1,2-Benzanthraquinone, >95.0%(HPLC). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 5g, 25g, 2g, 10g, 250mg, 50g, 100g.
Benzo[a]anthracene-7,12-dione (CAS 2498-66-0) is a chemical compound with the molecular formula C18H10O2 and a molecular weight of 258.3 g/mol. IUPAC name: benzo[a]anthracene-7,12-dione. InChIKey: LHMRXAIRPKSGDE-UHFFFAOYSA-N.
| Molecular formula | C18H10O2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | benzo[a]anthracene-7,12-dione |
| InChIKey | LHMRXAIRPKSGDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)