CAS 2304-83-8 is the registry number for 1,2-Chrysenedione. Offered by: TRC. Available pack sizes: 50mg.
Chrysene-1,2-dione (CAS 2304-83-8) is a chemical compound with the molecular formula C18H10O2 and a molecular weight of 258.3 g/mol. IUPAC name: chrysene-1,2-dione. InChIKey: KXQDINHHHLYVOC-UHFFFAOYSA-N.
| Molecular formula | C18H10O2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | chrysene-1,2-dione |
| InChIKey | KXQDINHHHLYVOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC4=C3C=CC(=O)C4=O |
Computed by PubChem (NCBI)