CAS 1980044-76-5 is the registry number for Methyl 2-(4-nitrophenyl)-2-(4-bromophenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Methyl 2-(4-bromophenyl)-2-(4-nitrophenyl)acetate (CAS 1980044-76-5) is a chemical compound with the molecular formula C15H12BrNO4 and a molecular weight of 350.16 g/mol. IUPAC name: methyl 2-(4-bromophenyl)-2-(4-nitrophenyl)acetate. InChIKey: AVOIZEZFNPOKBG-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO4 |
|---|---|
| Molecular weight | 350.16 g/mol |
| IUPAC name | methyl 2-(4-bromophenyl)-2-(4-nitrophenyl)acetate |
| InChIKey | AVOIZEZFNPOKBG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)[N+](=O)[O-])C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)