Products 2102411-41-4
CAS 2102411-41-4 appears in our catalog under these names: (4–bromo–3–methylphenyl)(4–methoxy–3–nitrophenyl)methanone, (4-Bromo-3-methylphenyl)(4-methoxy-3-nitrophenyl)methanone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(4-bromo-3-methylphenyl)-(4-methoxy-3-nitrophenyl)methanone (CAS 2102411-41-4) is a chemical compound with the molecular formula C15H12BrNO4 and a molecular weight of 350.16 g/mol. IUPAC name: (4-bromo-3-methylphenyl)-(4-methoxy-3-nitrophenyl)methanone. InChIKey: APJBUPHUJLURMZ-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO4 |
|---|---|
| Molecular weight | 350.16 g/mol |
| IUPAC name | (4-bromo-3-methylphenyl)-(4-methoxy-3-nitrophenyl)methanone |
| InChIKey | APJBUPHUJLURMZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C2=CC(=C(C=C2)OC)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)