CAS 329220-18-0 appears in our catalog under these names: 2-{((4-Bromophenyl)carbamoyl)methoxy}benzoic acid, 2-(2-((4-Bromophenyl)Amino)-2-Oxoethoxy)Benzoic Acid, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
2-[2-(4-bromoanilino)-2-oxoethoxy]benzoic acid (CAS 329220-18-0) is a chemical compound with the molecular formula C15H12BrNO4 and a molecular weight of 350.16 g/mol. IUPAC name: 2-[2-(4-bromoanilino)-2-oxoethoxy]benzoic acid. InChIKey: UHXGTJXEYLLGAC-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO4 |
|---|---|
| Molecular weight | 350.16 g/mol |
| IUPAC name | 2-[2-(4-bromoanilino)-2-oxoethoxy]benzoic acid |
| InChIKey | UHXGTJXEYLLGAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OCC(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)