Products 198134-15-5
CAS 198134-15-5 is the registry number for Fmoc-L-Asn(Ph)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2S)-4-anilino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (CAS 198134-15-5) is a chemical compound with the molecular formula C25H22N2O5 and a molecular weight of 430.5 g/mol. IUPAC name: (2S)-4-anilino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid. InChIKey: ODZSLYMDYGLXND-QFIPXVFZSA-N.
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (2S)-4-anilino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| InChIKey | ODZSLYMDYGLXND-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)