CAS 19825-40-2 is the registry number for 1-(2,4-Dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]ethanone (CAS 19825-40-2) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 1-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]ethanone. InChIKey: HUEWXRMYZUGMME-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 1-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]ethanone |
| InChIKey | HUEWXRMYZUGMME-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1O)C(=O)C)O)C |
Computed by PubChem (NCBI)