CAS 1983164-02-8 is the registry number for (1S,3s)-1-(3-bromophenyl)-3-hydroxycyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromophenyl)-3-hydroxycyclobutane-1-carboxylic acid (CAS 1983164-02-8) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: 1-(3-bromophenyl)-3-hydroxycyclobutane-1-carboxylic acid. InChIKey: IAHZTSYYWDQBKK-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 1-(3-bromophenyl)-3-hydroxycyclobutane-1-carboxylic acid |
| InChIKey | IAHZTSYYWDQBKK-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C2=CC(=CC=C2)Br)C(=O)O)O |
Computed by PubChem (NCBI)